About acetamide;3-methylpyridine;1-methylpyrrolidine
acetamide;3-methylpyridine;1-methylpyrrolidine (PubChem CID 143564714) has the molecular formula C13H23N3O
and a molecular weight of 237.35 g/mol. Its IUPAC name is acetamide;3-methylpyridine;1-methylpyrrolidine.
Molecular Properties
| Compound Name | acetamide;3-methylpyridine;1-methylpyrrolidine |
| PubChem CID | 143564714 |
| Molecular Formula | C13H23N3O |
| Molecular Weight | 237.35 g/mol |
| Exact Mass | 237.18 |
| IUPAC Name | acetamide;3-methylpyridine;1-methylpyrrolidine |
| SMILES | CC(N)=O.CN1CCCC1.Cc1cccnc1 |
| InChI | InChI=1S/C6H7N.C5H11N.C2H5NO/c1-6-3-2-4-7-5-6;1-6-4-2-3-5-6;1-2(3)4/h2-5H,1H3;2-5H2,1H3;1H3,(H2,3,4) |
| InChIKey | NKOWKJJRCUUQOL-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 59.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.35 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze acetamide;3-methylpyridine;1-methylpyrrolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetamide;3-methylpyridine;1-methylpyrrolidine?
The IUPAC name of acetamide;3-methylpyridine;1-methylpyrrolidine (CID 143564714) is acetamide;3-methylpyridine;1-methylpyrrolidine.
What is the SMILES notation for acetamide;3-methylpyridine;1-methylpyrrolidine?
The canonical SMILES for acetamide;3-methylpyridine;1-methylpyrrolidine is CC(N)=O.CN1CCCC1.Cc1cccnc1.
What is the InChIKey of acetamide;3-methylpyridine;1-methylpyrrolidine?
The InChIKey is NKOWKJJRCUUQOL-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7N.C5H11N.C2H5NO/c1-6-3-2-4-7-5-6;1-6-4-2-3-5-6;1-2(3)4/h2-5H,1H3;2-5H2,1H3;1H3,(H2,3,4).
What are the key properties of acetamide;3-methylpyridine;1-methylpyrrolidine?
acetamide;3-methylpyridine;1-methylpyrrolidine has a molecular weight of 237.35 g/mol, XLogP of 1.59, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for acetamide;3-methylpyridine;1-methylpyrrolidine is sourced from PubChem (CID 143564714), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).