About ethane;1-methyl-4-(4-methylphenyl)piperazine;3-methylpyridine
ethane;1-methyl-4-(4-methylphenyl)piperazine;3-methylpyridine (PubChem CID 177158844) has the molecular formula C22H37N3
and a molecular weight of 343.56 g/mol. Its IUPAC name is ethane;1-methyl-4-(4-methylphenyl)piperazine;3-methylpyridine.
Molecular Properties
| Compound Name | ethane;1-methyl-4-(4-methylphenyl)piperazine;3-methylpyridine |
| PubChem CID | 177158844 |
| Molecular Formula | C22H37N3 |
| Molecular Weight | 343.56 g/mol |
| Exact Mass | 343.30 |
| IUPAC Name | ethane;1-methyl-4-(4-methylphenyl)piperazine;3-methylpyridine |
| SMILES | CC.CC.Cc1ccc(N2CCN(C)CC2)cc1.Cc1cccnc1 |
| InChI | InChI=1S/C12H18N2.C6H7N.2C2H6/c1-11-3-5-12(6-4-11)14-9-7-13(2)8-10-14;1-6-3-2-4-7-5-6;2*1-2/h3-6H,7-10H2,1-2H3;2-5H,1H3;2*1-2H3 |
| InChIKey | SLEQNHDNAUFHEU-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 19.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 343.56 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|
Analyze ethane;1-methyl-4-(4-methylphenyl)piperazine;3-methylpyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;1-methyl-4-(4-methylphenyl)piperazine;3-methylpyridine?
The IUPAC name of ethane;1-methyl-4-(4-methylphenyl)piperazine;3-methylpyridine (CID 177158844) is ethane;1-methyl-4-(4-methylphenyl)piperazine;3-methylpyridine.
What is the SMILES notation for ethane;1-methyl-4-(4-methylphenyl)piperazine;3-methylpyridine?
The canonical SMILES for ethane;1-methyl-4-(4-methylphenyl)piperazine;3-methylpyridine is CC.CC.Cc1ccc(N2CCN(C)CC2)cc1.Cc1cccnc1.
What is the InChIKey of ethane;1-methyl-4-(4-methylphenyl)piperazine;3-methylpyridine?
The InChIKey is SLEQNHDNAUFHEU-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18N2.C6H7N.2C2H6/c1-11-3-5-12(6-4-11)14-9-7-13(2)8-10-14;1-6-3-2-4-7-5-6;2*1-2/h3-6H,7-10H2,1-2H3;2-5H,1H3;2*1-2H3.
What are the key properties of ethane;1-methyl-4-(4-methylphenyl)piperazine;3-methylpyridine?
ethane;1-methyl-4-(4-methylphenyl)piperazine;3-methylpyridine has a molecular weight of 343.56 g/mol, XLogP of 5.19, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;1-methyl-4-(4-methylphenyl)piperazine;3-methylpyridine is sourced from PubChem (CID 177158844), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).