C18H22N4O — CID 113108569
4-(4-methylphenyl)-N-(pyridin-3-ylmethyl)piperazine-1-carboxamide (PubChem CID 113108569) has the molecular formula C18H22N4O and a molecular weight of 310.40 g/mol. Its IUPAC name is 4-(4-methylphenyl)-N-(pyridin-3-ylmethyl)piperazine-1-carboxamide.
| Compound Name | 4-(4-methylphenyl)-N-(pyridin-3-ylmethyl)piperazine-1-carboxamide |
|---|---|
| PubChem CID | 113108569 |
| Molecular Formula | C18H22N4O |
| Molecular Weight | 310.40 g/mol |
| Exact Mass | 310.18 |
| IUPAC Name | 4-(4-methylphenyl)-N-(pyridin-3-ylmethyl)piperazine-1-carboxamide |
| SMILES | Cc1ccc(N2CCN(C(=O)NCc3cccnc3)CC2)cc1 |
| InChI | InChI=1S/C18H22N4O/c1-15-4-6-17(7-5-15)21-9-11-22(12-10-21)18(23)20-14-16-3-2-8-19-13-16/h2-8,13H,9-12,14H2,1H3,(H,20,23) |
| InChIKey | QHFXQKTUEZOEIG-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 48.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.40 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|