C17H19N5O3 — CID 25359833
4-(4-nitrophenyl)-N-(pyridin-3-ylmethyl)piperazine-1-carboxamide (PubChem CID 25359833) has the molecular formula C17H19N5O3 and a molecular weight of 341.37 g/mol. Its IUPAC name is 4-(4-nitrophenyl)-N-(pyridin-3-ylmethyl)piperazine-1-carboxamide.
| Compound Name | 4-(4-nitrophenyl)-N-(pyridin-3-ylmethyl)piperazine-1-carboxamide |
|---|---|
| PubChem CID | 25359833 |
| Molecular Formula | C17H19N5O3 |
| Molecular Weight | 341.37 g/mol |
| Exact Mass | 341.15 |
| IUPAC Name | 4-(4-nitrophenyl)-N-(pyridin-3-ylmethyl)piperazine-1-carboxamide |
| SMILES | O=C(NCc1cccnc1)N1CCN(c2ccc([N+](=O)[O-])cc2)CC1 |
| InChI | InChI=1S/C17H19N5O3/c23-17(19-13-14-2-1-7-18-12-14)21-10-8-20(9-11-21)15-3-5-16(6-4-15)22(24)25/h1-7,12H,8-11,13H2,(H,19,23) |
| InChIKey | BTYZVSOGOAIAKL-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 91.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.37 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|