C16H17N7O4 — CID 24616065
N'-[4-(4-nitrophenyl)piperazine-1-carbonyl]pyrazine-2-carbohydrazide (PubChem CID 24616065) has the molecular formula C16H17N7O4 and a molecular weight of 371.36 g/mol. Its IUPAC name is N'-[4-(4-nitrophenyl)piperazine-1-carbonyl]pyrazine-2-carbohydrazide.
| Compound Name | N'-[4-(4-nitrophenyl)piperazine-1-carbonyl]pyrazine-2-carbohydrazide |
|---|---|
| PubChem CID | 24616065 |
| Molecular Formula | C16H17N7O4 |
| Molecular Weight | 371.36 g/mol |
| Exact Mass | 371.13 |
| IUPAC Name | N'-[4-(4-nitrophenyl)piperazine-1-carbonyl]pyrazine-2-carbohydrazide |
| SMILES | O=C(NNC(=O)N1CCN(c2ccc([N+](=O)[O-])cc2)CC1)c1cnccn1 |
| InChI | InChI=1S/C16H17N7O4/c24-15(14-11-17-5-6-18-14)19-20-16(25)22-9-7-21(8-10-22)12-1-3-13(4-2-12)23(26)27/h1-6,11H,7-10H2,(H,19,24)(H,20,25) |
| InChIKey | QKOBBEHMWNFEOZ-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 133.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.36 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|