C21H21N5O2S — CID 53336035
N-[2-[4-(4-methylphenyl)piperazine-1-carbonyl]thiophen-3-yl]pyrazine-2-carboxamide (PubChem CID 53336035) has the molecular formula C21H21N5O2S and a molecular weight of 407.50 g/mol. Its IUPAC name is N-[2-[4-(4-methylphenyl)piperazine-1-carbonyl]thiophen-3-yl]pyrazine-2-carboxamide.
| Compound Name | N-[2-[4-(4-methylphenyl)piperazine-1-carbonyl]thiophen-3-yl]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 53336035 |
| Molecular Formula | C21H21N5O2S |
| Molecular Weight | 407.50 g/mol |
| Exact Mass | 407.14 |
| IUPAC Name | N-[2-[4-(4-methylphenyl)piperazine-1-carbonyl]thiophen-3-yl]pyrazine-2-carboxamide |
| SMILES | Cc1ccc(N2CCN(C(=O)c3sccc3NC(=O)c3cnccn3)CC2)cc1 |
| InChI | InChI=1S/C21H21N5O2S/c1-15-2-4-16(5-3-15)25-9-11-26(12-10-25)21(28)19-17(6-13-29-19)24-20(27)18-14-22-7-8-23-18/h2-8,13-14H,9-12H2,1H3,(H,24,27) |
| InChIKey | XEEJDTJSAGVNTO-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.50 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|