C22H25N5OS — CID 26359267
N-[4-[4-[[(1R)-1-thiophen-2-ylethyl]amino]piperidin-1-yl]phenyl]pyrazine-2-carboxamide (PubChem CID 26359267) has the molecular formula C22H25N5OS and a molecular weight of 407.54 g/mol. Its IUPAC name is N-[4-[4-[[(1R)-1-thiophen-2-ylethyl]amino]piperidin-1-yl]phenyl]pyrazine-2-carboxamide.
| Compound Name | N-[4-[4-[[(1R)-1-thiophen-2-ylethyl]amino]piperidin-1-yl]phenyl]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 26359267 |
| Molecular Formula | C22H25N5OS |
| Molecular Weight | 407.54 g/mol |
| Exact Mass | 407.18 |
| IUPAC Name | N-[4-[4-[[(1R)-1-thiophen-2-ylethyl]amino]piperidin-1-yl]phenyl]pyrazine-2-carboxamide |
| SMILES | C[C@@H](NC1CCN(c2ccc(NC(=O)c3cnccn3)cc2)CC1)c1cccs1 |
| InChI | InChI=1S/C22H25N5OS/c1-16(21-3-2-14-29-21)25-18-8-12-27(13-9-18)19-6-4-17(5-7-19)26-22(28)20-15-23-10-11-24-20/h2-7,10-11,14-16,18,25H,8-9,12-13H2,1H3,(H,26,28)/t16-/m1/s1 |
| InChIKey | GMVNQYWNAVGTBM-MRXNPFEDSA-N |
| XLogP | 4.11 |
| TPSA | 70.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.54 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|