C23H26N4OS — CID 45201861
N-[3-[4-(1-thiophen-2-ylethylamino)piperidin-1-yl]phenyl]pyridine-3-carboxamide (PubChem CID 45201861) has the molecular formula C23H26N4OS and a molecular weight of 406.56 g/mol. Its IUPAC name is N-[3-[4-(1-thiophen-2-ylethylamino)piperidin-1-yl]phenyl]pyridine-3-carboxamide.
| Compound Name | N-[3-[4-(1-thiophen-2-ylethylamino)piperidin-1-yl]phenyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 45201861 |
| Molecular Formula | C23H26N4OS |
| Molecular Weight | 406.56 g/mol |
| Exact Mass | 406.18 |
| IUPAC Name | N-[3-[4-(1-thiophen-2-ylethylamino)piperidin-1-yl]phenyl]pyridine-3-carboxamide |
| SMILES | CC(NC1CCN(c2cccc(NC(=O)c3cccnc3)c2)CC1)c1cccs1 |
| InChI | InChI=1S/C23H26N4OS/c1-17(22-8-4-14-29-22)25-19-9-12-27(13-10-19)21-7-2-6-20(15-21)26-23(28)18-5-3-11-24-16-18/h2-8,11,14-17,19,25H,9-10,12-13H2,1H3,(H,26,28) |
| InChIKey | WPJHNUGCMSQEGZ-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 57.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.56 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |