C25H27N5O — CID 126466841
N-[4-[4-(2,3-dihydro-1H-inden-1-ylamino)piperidin-1-yl]phenyl]pyrazine-2-carboxamide (PubChem CID 126466841) has the molecular formula C25H27N5O and a molecular weight of 413.53 g/mol. Its IUPAC name is N-[4-[4-(2,3-dihydro-1H-inden-1-ylamino)piperidin-1-yl]phenyl]pyrazine-2-carboxamide.
| Compound Name | N-[4-[4-(2,3-dihydro-1H-inden-1-ylamino)piperidin-1-yl]phenyl]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 126466841 |
| Molecular Formula | C25H27N5O |
| Molecular Weight | 413.53 g/mol |
| Exact Mass | 413.22 |
| IUPAC Name | N-[4-[4-(2,3-dihydro-1H-inden-1-ylamino)piperidin-1-yl]phenyl]pyrazine-2-carboxamide |
| SMILES | O=C(Nc1ccc(N2CCC(NC3CCc4ccccc43)CC2)cc1)c1cnccn1 |
| InChI | InChI=1S/C25H27N5O/c31-25(24-17-26-13-14-27-24)29-19-6-8-21(9-7-19)30-15-11-20(12-16-30)28-23-10-5-18-3-1-2-4-22(18)23/h1-4,6-9,13-14,17,20,23,28H,5,10-12,15-16H2,(H,29,31) |
| InChIKey | CJMKCMMOPHUIBK-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 70.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.53 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|