C15H15N5O2 — CID 110666649
N-[4-(2-oxo-1,3-diazinan-1-yl)phenyl]pyrazine-2-carboxamide (PubChem CID 110666649) has the molecular formula C15H15N5O2 and a molecular weight of 297.32 g/mol. Its IUPAC name is N-[4-(2-oxo-1,3-diazinan-1-yl)phenyl]pyrazine-2-carboxamide.
| Compound Name | N-[4-(2-oxo-1,3-diazinan-1-yl)phenyl]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 110666649 |
| Molecular Formula | C15H15N5O2 |
| Molecular Weight | 297.32 g/mol |
| Exact Mass | 297.12 |
| IUPAC Name | N-[4-(2-oxo-1,3-diazinan-1-yl)phenyl]pyrazine-2-carboxamide |
| SMILES | O=C(Nc1ccc(N2CCCNC2=O)cc1)c1cnccn1 |
| InChI | InChI=1S/C15H15N5O2/c21-14(13-10-16-7-8-17-13)19-11-2-4-12(5-3-11)20-9-1-6-18-15(20)22/h2-5,7-8,10H,1,6,9H2,(H,18,22)(H,19,21) |
| InChIKey | AXQFUAGBIOMAIK-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 87.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.32 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |