C19H21N3O2 — CID 110666698
3,4-dimethyl-N-[4-(2-oxo-1,3-diazinan-1-yl)phenyl]benzamide (PubChem CID 110666698) has the molecular formula C19H21N3O2 and a molecular weight of 323.40 g/mol. Its IUPAC name is 3,4-dimethyl-N-[4-(2-oxo-1,3-diazinan-1-yl)phenyl]benzamide.
| Compound Name | 3,4-dimethyl-N-[4-(2-oxo-1,3-diazinan-1-yl)phenyl]benzamide |
|---|---|
| PubChem CID | 110666698 |
| Molecular Formula | C19H21N3O2 |
| Molecular Weight | 323.40 g/mol |
| Exact Mass | 323.16 |
| IUPAC Name | 3,4-dimethyl-N-[4-(2-oxo-1,3-diazinan-1-yl)phenyl]benzamide |
| SMILES | Cc1ccc(C(=O)Nc2ccc(N3CCCNC3=O)cc2)cc1C |
| InChI | InChI=1S/C19H21N3O2/c1-13-4-5-15(12-14(13)2)18(23)21-16-6-8-17(9-7-16)22-11-3-10-20-19(22)24/h4-9,12H,3,10-11H2,1-2H3,(H,20,24)(H,21,23) |
| InChIKey | GCUQELOIPBRFGA-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.40 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |