C17H16BrN3O2 — CID 110666688
3-bromo-N-[4-(2-oxo-1,3-diazinan-1-yl)phenyl]benzamide (PubChem CID 110666688) has the molecular formula C17H16BrN3O2 and a molecular weight of 374.24 g/mol. Its IUPAC name is 3-bromo-N-[4-(2-oxo-1,3-diazinan-1-yl)phenyl]benzamide.
| Compound Name | 3-bromo-N-[4-(2-oxo-1,3-diazinan-1-yl)phenyl]benzamide |
|---|---|
| PubChem CID | 110666688 |
| Molecular Formula | C17H16BrN3O2 |
| Molecular Weight | 374.24 g/mol |
| Exact Mass | 373.04 |
| IUPAC Name | 3-bromo-N-[4-(2-oxo-1,3-diazinan-1-yl)phenyl]benzamide |
| SMILES | O=C(Nc1ccc(N2CCCNC2=O)cc1)c1cccc(Br)c1 |
| InChI | InChI=1S/C17H16BrN3O2/c18-13-4-1-3-12(11-13)16(22)20-14-5-7-15(8-6-14)21-10-2-9-19-17(21)23/h1,3-8,11H,2,9-10H2,(H,19,23)(H,20,22) |
| InChIKey | AQPOCIJFOUDOTH-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.24 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |