C18H17N3O4 — CID 110666657
N-[4-(2-oxo-1,3-diazinan-1-yl)phenyl]-1,3-benzodioxole-5-carboxamide (PubChem CID 110666657) has the molecular formula C18H17N3O4 and a molecular weight of 339.35 g/mol. Its IUPAC name is N-[4-(2-oxo-1,3-diazinan-1-yl)phenyl]-1,3-benzodioxole-5-carboxamide.
| Compound Name | N-[4-(2-oxo-1,3-diazinan-1-yl)phenyl]-1,3-benzodioxole-5-carboxamide |
|---|---|
| PubChem CID | 110666657 |
| Molecular Formula | C18H17N3O4 |
| Molecular Weight | 339.35 g/mol |
| Exact Mass | 339.12 |
| IUPAC Name | N-[4-(2-oxo-1,3-diazinan-1-yl)phenyl]-1,3-benzodioxole-5-carboxamide |
| SMILES | O=C(Nc1ccc(N2CCCNC2=O)cc1)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C18H17N3O4/c22-17(12-2-7-15-16(10-12)25-11-24-15)20-13-3-5-14(6-4-13)21-9-1-8-19-18(21)23/h2-7,10H,1,8-9,11H2,(H,19,23)(H,20,22) |
| InChIKey | OIKWECZWXBDBHS-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.35 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |