C14H12N4O3 — CID 110668697
N-[4-(2-oxo-1,3-oxazolidin-3-yl)phenyl]pyrazine-2-carboxamide (PubChem CID 110668697) has the molecular formula C14H12N4O3 and a molecular weight of 284.27 g/mol. Its IUPAC name is N-[4-(2-oxo-1,3-oxazolidin-3-yl)phenyl]pyrazine-2-carboxamide.
| Compound Name | N-[4-(2-oxo-1,3-oxazolidin-3-yl)phenyl]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 110668697 |
| Molecular Formula | C14H12N4O3 |
| Molecular Weight | 284.27 g/mol |
| Exact Mass | 284.09 |
| IUPAC Name | N-[4-(2-oxo-1,3-oxazolidin-3-yl)phenyl]pyrazine-2-carboxamide |
| SMILES | O=C(Nc1ccc(N2CCOC2=O)cc1)c1cnccn1 |
| InChI | InChI=1S/C14H12N4O3/c19-13(12-9-15-5-6-16-12)17-10-1-3-11(4-2-10)18-7-8-21-14(18)20/h1-6,9H,7-8H2,(H,17,19) |
| InChIKey | DJOBSMOWBCPFDP-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 84.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.27 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |