C17H18N4O3 — CID 60545752
1-[4-(2-oxo-1,3-oxazolidin-3-yl)phenyl]-3-(2-pyridin-2-ylethyl)urea (PubChem CID 60545752) has the molecular formula C17H18N4O3 and a molecular weight of 326.36 g/mol. Its IUPAC name is 1-[4-(2-oxo-1,3-oxazolidin-3-yl)phenyl]-3-(2-pyridin-2-ylethyl)urea.
| Compound Name | 1-[4-(2-oxo-1,3-oxazolidin-3-yl)phenyl]-3-(2-pyridin-2-ylethyl)urea |
|---|---|
| PubChem CID | 60545752 |
| Molecular Formula | C17H18N4O3 |
| Molecular Weight | 326.36 g/mol |
| Exact Mass | 326.14 |
| IUPAC Name | 1-[4-(2-oxo-1,3-oxazolidin-3-yl)phenyl]-3-(2-pyridin-2-ylethyl)urea |
| SMILES | O=C(NCCc1ccccn1)Nc1ccc(N2CCOC2=O)cc1 |
| InChI | InChI=1S/C17H18N4O3/c22-16(19-10-8-13-3-1-2-9-18-13)20-14-4-6-15(7-5-14)21-11-12-24-17(21)23/h1-7,9H,8,10-12H2,(H2,19,20,22) |
| InChIKey | KICCQBZGYBDOMJ-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.36 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |