C21H22N4OS — CID 60612010
1-[4-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)phenyl]-3-(2-pyridin-2-ylethyl)urea (PubChem CID 60612010) has the molecular formula C21H22N4OS and a molecular weight of 378.50 g/mol. Its IUPAC name is 1-[4-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)phenyl]-3-(2-pyridin-2-ylethyl)urea.
| Compound Name | 1-[4-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)phenyl]-3-(2-pyridin-2-ylethyl)urea |
|---|---|
| PubChem CID | 60612010 |
| Molecular Formula | C21H22N4OS |
| Molecular Weight | 378.50 g/mol |
| Exact Mass | 378.15 |
| IUPAC Name | 1-[4-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)phenyl]-3-(2-pyridin-2-ylethyl)urea |
| SMILES | O=C(NCCc1ccccn1)Nc1ccc(N2CCc3sccc3C2)cc1 |
| InChI | InChI=1S/C21H22N4OS/c26-21(23-12-8-17-3-1-2-11-22-17)24-18-4-6-19(7-5-18)25-13-9-20-16(15-25)10-14-27-20/h1-7,10-11,14H,8-9,12-13,15H2,(H2,23,24,26) |
| InChIKey | FHMKSHALJFZHLT-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 57.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.50 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|