C19H23N3O3S — CID 51129942
ethyl N-[3-[4-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)anilino]-3-oxopropyl]carbamate (PubChem CID 51129942) has the molecular formula C19H23N3O3S and a molecular weight of 373.48 g/mol. Its IUPAC name is ethyl N-[3-[4-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)anilino]-3-oxopropyl]carbamate.
| Compound Name | ethyl N-[3-[4-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)anilino]-3-oxopropyl]carbamate |
|---|---|
| PubChem CID | 51129942 |
| Molecular Formula | C19H23N3O3S |
| Molecular Weight | 373.48 g/mol |
| Exact Mass | 373.15 |
| IUPAC Name | ethyl N-[3-[4-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)anilino]-3-oxopropyl]carbamate |
| SMILES | CCOC(=O)NCCC(=O)Nc1ccc(N2CCc3sccc3C2)cc1 |
| InChI | InChI=1S/C19H23N3O3S/c1-2-25-19(24)20-10-7-18(23)21-15-3-5-16(6-4-15)22-11-8-17-14(13-22)9-12-26-17/h3-6,9,12H,2,7-8,10-11,13H2,1H3,(H,20,24)(H,21,23) |
| InChIKey | XTWWCIJBMGXTQC-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.48 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|