C20H25N3OS — CID 51476386
2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-N-(4-piperidin-1-ylphenyl)acetamide (PubChem CID 51476386) has the molecular formula C20H25N3OS and a molecular weight of 355.51 g/mol. Its IUPAC name is 2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-N-(4-piperidin-1-ylphenyl)acetamide.
| Compound Name | 2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-N-(4-piperidin-1-ylphenyl)acetamide |
|---|---|
| PubChem CID | 51476386 |
| Molecular Formula | C20H25N3OS |
| Molecular Weight | 355.51 g/mol |
| Exact Mass | 355.17 |
| IUPAC Name | 2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-N-(4-piperidin-1-ylphenyl)acetamide |
| SMILES | O=C(CN1CCc2sccc2C1)Nc1ccc(N2CCCCC2)cc1 |
| InChI | InChI=1S/C20H25N3OS/c24-20(15-22-12-8-19-16(14-22)9-13-25-19)21-17-4-6-18(7-5-17)23-10-2-1-3-11-23/h4-7,9,13H,1-3,8,10-12,14-15H2,(H,21,24) |
| InChIKey | YHZZNWHEINFQLW-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.51 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|