C17H24N4O2 — CID 108995838
2-(4-formylpiperazin-1-yl)-N-(4-pyrrolidin-1-ylphenyl)acetamide (PubChem CID 108995838) has the molecular formula C17H24N4O2 and a molecular weight of 316.40 g/mol. Its IUPAC name is 2-(4-formylpiperazin-1-yl)-N-(4-pyrrolidin-1-ylphenyl)acetamide.
| Compound Name | 2-(4-formylpiperazin-1-yl)-N-(4-pyrrolidin-1-ylphenyl)acetamide |
|---|---|
| PubChem CID | 108995838 |
| Molecular Formula | C17H24N4O2 |
| Molecular Weight | 316.40 g/mol |
| Exact Mass | 316.19 |
| IUPAC Name | 2-(4-formylpiperazin-1-yl)-N-(4-pyrrolidin-1-ylphenyl)acetamide |
| SMILES | O=CN1CCN(CC(=O)Nc2ccc(N3CCCC3)cc2)CC1 |
| InChI | InChI=1S/C17H24N4O2/c22-14-20-11-9-19(10-12-20)13-17(23)18-15-3-5-16(6-4-15)21-7-1-2-8-21/h3-6,14H,1-2,7-13H2,(H,18,23) |
| InChIKey | VAYIHPAVKDOMIC-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 55.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.40 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|