C23H30N4O3S — CID 27175232
2-[4-(benzenesulfonyl)piperazin-1-yl]-N-(4-piperidin-1-ylphenyl)acetamide (PubChem CID 27175232) has the molecular formula C23H30N4O3S and a molecular weight of 442.59 g/mol. Its IUPAC name is 2-[4-(benzenesulfonyl)piperazin-1-yl]-N-(4-piperidin-1-ylphenyl)acetamide.
| Compound Name | 2-[4-(benzenesulfonyl)piperazin-1-yl]-N-(4-piperidin-1-ylphenyl)acetamide |
|---|---|
| PubChem CID | 27175232 |
| Molecular Formula | C23H30N4O3S |
| Molecular Weight | 442.59 g/mol |
| Exact Mass | 442.20 |
| IUPAC Name | 2-[4-(benzenesulfonyl)piperazin-1-yl]-N-(4-piperidin-1-ylphenyl)acetamide |
| SMILES | O=C(CN1CCN(S(=O)(=O)c2ccccc2)CC1)Nc1ccc(N2CCCCC2)cc1 |
| InChI | InChI=1S/C23H30N4O3S/c28-23(24-20-9-11-21(12-10-20)26-13-5-2-6-14-26)19-25-15-17-27(18-16-25)31(29,30)22-7-3-1-4-8-22/h1,3-4,7-12H,2,5-6,13-19H2,(H,24,28) |
| InChIKey | GYQVLBXTVFKWLN-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 72.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.59 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|