C22H27ClN4O3S — CID 4818491
2-[4-(2-chlorophenyl)piperazin-1-yl]-N-(4-pyrrolidin-1-ylsulfonylphenyl)acetamide (PubChem CID 4818491) has the molecular formula C22H27ClN4O3S and a molecular weight of 463.00 g/mol. Its IUPAC name is 2-[4-(2-chlorophenyl)piperazin-1-yl]-N-(4-pyrrolidin-1-ylsulfonylphenyl)acetamide.
| Compound Name | 2-[4-(2-chlorophenyl)piperazin-1-yl]-N-(4-pyrrolidin-1-ylsulfonylphenyl)acetamide |
|---|---|
| PubChem CID | 4818491 |
| Molecular Formula | C22H27ClN4O3S |
| Molecular Weight | 463.00 g/mol |
| Exact Mass | 462.15 |
| IUPAC Name | 2-[4-(2-chlorophenyl)piperazin-1-yl]-N-(4-pyrrolidin-1-ylsulfonylphenyl)acetamide |
| SMILES | O=C(CN1CCN(c2ccccc2Cl)CC1)Nc1ccc(S(=O)(=O)N2CCCC2)cc1 |
| InChI | InChI=1S/C22H27ClN4O3S/c23-20-5-1-2-6-21(20)26-15-13-25(14-16-26)17-22(28)24-18-7-9-19(10-8-18)31(29,30)27-11-3-4-12-27/h1-2,5-10H,3-4,11-17H2,(H,24,28) |
| InChIKey | NQSYUOHVVJCRIA-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 72.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.00 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |