C23H28N8O — CID 55601224
2-[4-(1-phenyltetrazol-5-yl)piperazin-1-yl]-N-(4-pyrrolidin-1-ylphenyl)acetamide (PubChem CID 55601224) has the molecular formula C23H28N8O and a molecular weight of 432.53 g/mol. Its IUPAC name is 2-[4-(1-phenyltetrazol-5-yl)piperazin-1-yl]-N-(4-pyrrolidin-1-ylphenyl)acetamide.
| Compound Name | 2-[4-(1-phenyltetrazol-5-yl)piperazin-1-yl]-N-(4-pyrrolidin-1-ylphenyl)acetamide |
|---|---|
| PubChem CID | 55601224 |
| Molecular Formula | C23H28N8O |
| Molecular Weight | 432.53 g/mol |
| Exact Mass | 432.24 |
| IUPAC Name | 2-[4-(1-phenyltetrazol-5-yl)piperazin-1-yl]-N-(4-pyrrolidin-1-ylphenyl)acetamide |
| SMILES | O=C(CN1CCN(c2nnnn2-c2ccccc2)CC1)Nc1ccc(N2CCCC2)cc1 |
| InChI | InChI=1S/C23H28N8O/c32-22(24-19-8-10-20(11-9-19)29-12-4-5-13-29)18-28-14-16-30(17-15-28)23-25-26-27-31(23)21-6-2-1-3-7-21/h1-3,6-11H,4-5,12-18H2,(H,24,32) |
| InChIKey | QEBUJUXBGFGBAD-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 82.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.53 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|