C20H23N7O3S — CID 55601214
N-(4-methylsulfonylphenyl)-2-[4-(1-phenyltetrazol-5-yl)piperazin-1-yl]acetamide (PubChem CID 55601214) has the molecular formula C20H23N7O3S and a molecular weight of 441.52 g/mol. Its IUPAC name is N-(4-methylsulfonylphenyl)-2-[4-(1-phenyltetrazol-5-yl)piperazin-1-yl]acetamide.
| Compound Name | N-(4-methylsulfonylphenyl)-2-[4-(1-phenyltetrazol-5-yl)piperazin-1-yl]acetamide |
|---|---|
| PubChem CID | 55601214 |
| Molecular Formula | C20H23N7O3S |
| Molecular Weight | 441.52 g/mol |
| Exact Mass | 441.16 |
| IUPAC Name | N-(4-methylsulfonylphenyl)-2-[4-(1-phenyltetrazol-5-yl)piperazin-1-yl]acetamide |
| SMILES | CS(=O)(=O)c1ccc(NC(=O)CN2CCN(c3nnnn3-c3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C20H23N7O3S/c1-31(29,30)18-9-7-16(8-10-18)21-19(28)15-25-11-13-26(14-12-25)20-22-23-24-27(20)17-5-3-2-4-6-17/h2-10H,11-15H2,1H3,(H,21,28) |
| InChIKey | IUSJVNAFCFFVGX-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 113.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.52 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |