C18H26N8O3S — CID 55601179
1-(4-methylsulfonylpiperazin-1-yl)-2-[4-(1-phenyltetrazol-5-yl)piperazin-1-yl]ethanone (PubChem CID 55601179) has the molecular formula C18H26N8O3S and a molecular weight of 434.53 g/mol. Its IUPAC name is 1-(4-methylsulfonylpiperazin-1-yl)-2-[4-(1-phenyltetrazol-5-yl)piperazin-1-yl]ethanone.
| Compound Name | 1-(4-methylsulfonylpiperazin-1-yl)-2-[4-(1-phenyltetrazol-5-yl)piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 55601179 |
| Molecular Formula | C18H26N8O3S |
| Molecular Weight | 434.53 g/mol |
| Exact Mass | 434.18 |
| IUPAC Name | 1-(4-methylsulfonylpiperazin-1-yl)-2-[4-(1-phenyltetrazol-5-yl)piperazin-1-yl]ethanone |
| SMILES | CS(=O)(=O)N1CCN(C(=O)CN2CCN(c3nnnn3-c3ccccc3)CC2)CC1 |
| InChI | InChI=1S/C18H26N8O3S/c1-30(28,29)25-13-11-23(12-14-25)17(27)15-22-7-9-24(10-8-22)18-19-20-21-26(18)16-5-3-2-4-6-16/h2-6H,7-15H2,1H3 |
| InChIKey | SPECCDGEHXXMID-UHFFFAOYSA-N |
| XLogP | -1.11 |
| TPSA | 107.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.53 |
| LogP ≤ 5 | -1.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |