C13H17N7S — CID 63337234
2-[4-(1-phenyltetrazol-5-yl)piperazin-1-yl]ethanethioamide (PubChem CID 63337234) has the molecular formula C13H17N7S and a molecular weight of 303.39 g/mol. Its IUPAC name is 2-[4-(1-phenyltetrazol-5-yl)piperazin-1-yl]ethanethioamide.
| Compound Name | 2-[4-(1-phenyltetrazol-5-yl)piperazin-1-yl]ethanethioamide |
|---|---|
| PubChem CID | 63337234 |
| Molecular Formula | C13H17N7S |
| Molecular Weight | 303.39 g/mol |
| Exact Mass | 303.13 |
| IUPAC Name | 2-[4-(1-phenyltetrazol-5-yl)piperazin-1-yl]ethanethioamide |
| SMILES | NC(=S)CN1CCN(c2nnnn2-c2ccccc2)CC1 |
| InChI | InChI=1S/C13H17N7S/c14-12(21)10-18-6-8-19(9-7-18)13-15-16-17-20(13)11-4-2-1-3-5-11/h1-5H,6-10H2,(H2,14,21) |
| InChIKey | PYSBGNRYYJVVLZ-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 76.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.39 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|