C14H20N6O — CID 63309679
2-[4-(1-phenyltetrazol-5-yl)-1,4-diazepan-1-yl]ethanol (PubChem CID 63309679) has the molecular formula C14H20N6O and a molecular weight of 288.35 g/mol. Its IUPAC name is 2-[4-(1-phenyltetrazol-5-yl)-1,4-diazepan-1-yl]ethanol.
| Compound Name | 2-[4-(1-phenyltetrazol-5-yl)-1,4-diazepan-1-yl]ethanol |
|---|---|
| PubChem CID | 63309679 |
| Molecular Formula | C14H20N6O |
| Molecular Weight | 288.35 g/mol |
| Exact Mass | 288.17 |
| IUPAC Name | 2-[4-(1-phenyltetrazol-5-yl)-1,4-diazepan-1-yl]ethanol |
| SMILES | OCCN1CCCN(c2nnnn2-c2ccccc2)CC1 |
| InChI | InChI=1S/C14H20N6O/c21-12-11-18-7-4-8-19(10-9-18)14-15-16-17-20(14)13-5-2-1-3-6-13/h1-3,5-6,21H,4,7-12H2 |
| InChIKey | VPEFLKBNMWOODX-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 70.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.35 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |