C12H16N6O2S — CID 27306331
1-methylsulfonyl-4-(1-phenyltetrazol-5-yl)piperazine (PubChem CID 27306331) has the molecular formula C12H16N6O2S and a molecular weight of 308.37 g/mol. Its IUPAC name is 1-methylsulfonyl-4-(1-phenyltetrazol-5-yl)piperazine.
| Compound Name | 1-methylsulfonyl-4-(1-phenyltetrazol-5-yl)piperazine |
|---|---|
| PubChem CID | 27306331 |
| Molecular Formula | C12H16N6O2S |
| Molecular Weight | 308.37 g/mol |
| Exact Mass | 308.11 |
| IUPAC Name | 1-methylsulfonyl-4-(1-phenyltetrazol-5-yl)piperazine |
| SMILES | CS(=O)(=O)N1CCN(c2nnnn2-c2ccccc2)CC1 |
| InChI | InChI=1S/C12H16N6O2S/c1-21(19,20)17-9-7-16(8-10-17)12-13-14-15-18(12)11-5-3-2-4-6-11/h2-6H,7-10H2,1H3 |
| InChIKey | LWVRZCHUGODURL-UHFFFAOYSA-N |
| XLogP | -0.26 |
| TPSA | 84.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.37 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |