C23H27N7O3S — CID 46600592
[1-(benzenesulfonyl)piperidin-4-yl]-[4-(1-phenyltetrazol-5-yl)piperazin-1-yl]methanone (PubChem CID 46600592) has the molecular formula C23H27N7O3S and a molecular weight of 481.58 g/mol. Its IUPAC name is [1-(benzenesulfonyl)piperidin-4-yl]-[4-(1-phenyltetrazol-5-yl)piperazin-1-yl]methanone.
| Compound Name | [1-(benzenesulfonyl)piperidin-4-yl]-[4-(1-phenyltetrazol-5-yl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 46600592 |
| Molecular Formula | C23H27N7O3S |
| Molecular Weight | 481.58 g/mol |
| Exact Mass | 481.19 |
| IUPAC Name | [1-(benzenesulfonyl)piperidin-4-yl]-[4-(1-phenyltetrazol-5-yl)piperazin-1-yl]methanone |
| SMILES | O=C(C1CCN(S(=O)(=O)c2ccccc2)CC1)N1CCN(c2nnnn2-c2ccccc2)CC1 |
| InChI | InChI=1S/C23H27N7O3S/c31-22(19-11-13-29(14-12-19)34(32,33)21-9-5-2-6-10-21)27-15-17-28(18-16-27)23-24-25-26-30(23)20-7-3-1-4-8-20/h1-10,19H,11-18H2 |
| InChIKey | ZWANHZKDNPUCBL-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 104.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.58 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |