C25H22N6O2 — CID 46600637
[4-(1-phenyltetrazol-5-yl)piperazin-1-yl]-(9H-xanthen-9-yl)methanone (PubChem CID 46600637) has the molecular formula C25H22N6O2 and a molecular weight of 438.49 g/mol. Its IUPAC name is [4-(1-phenyltetrazol-5-yl)piperazin-1-yl]-(9H-xanthen-9-yl)methanone.
| Compound Name | [4-(1-phenyltetrazol-5-yl)piperazin-1-yl]-(9H-xanthen-9-yl)methanone |
|---|---|
| PubChem CID | 46600637 |
| Molecular Formula | C25H22N6O2 |
| Molecular Weight | 438.49 g/mol |
| Exact Mass | 438.18 |
| IUPAC Name | [4-(1-phenyltetrazol-5-yl)piperazin-1-yl]-(9H-xanthen-9-yl)methanone |
| SMILES | O=C(C1c2ccccc2Oc2ccccc21)N1CCN(c2nnnn2-c2ccccc2)CC1 |
| InChI | InChI=1S/C25H22N6O2/c32-24(23-19-10-4-6-12-21(19)33-22-13-7-5-11-20(22)23)29-14-16-30(17-15-29)25-26-27-28-31(25)18-8-2-1-3-9-18/h1-13,23H,14-17H2 |
| InChIKey | VIJDHTPSIRHFGR-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 76.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.49 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |