C17H25N3O5S2 — CID 26020158
[4-(benzenesulfonyl)piperazin-1-yl]-(1-methylsulfonylpiperidin-4-yl)methanone (PubChem CID 26020158) has the molecular formula C17H25N3O5S2 and a molecular weight of 415.54 g/mol. Its IUPAC name is [4-(benzenesulfonyl)piperazin-1-yl]-(1-methylsulfonylpiperidin-4-yl)methanone.
| Compound Name | [4-(benzenesulfonyl)piperazin-1-yl]-(1-methylsulfonylpiperidin-4-yl)methanone |
|---|---|
| PubChem CID | 26020158 |
| Molecular Formula | C17H25N3O5S2 |
| Molecular Weight | 415.54 g/mol |
| Exact Mass | 415.12 |
| IUPAC Name | [4-(benzenesulfonyl)piperazin-1-yl]-(1-methylsulfonylpiperidin-4-yl)methanone |
| SMILES | CS(=O)(=O)N1CCC(C(=O)N2CCN(S(=O)(=O)c3ccccc3)CC2)CC1 |
| InChI | InChI=1S/C17H25N3O5S2/c1-26(22,23)19-9-7-15(8-10-19)17(21)18-11-13-20(14-12-18)27(24,25)16-5-3-2-4-6-16/h2-6,15H,7-14H2,1H3 |
| InChIKey | WIHMKONTGPQXEQ-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 95.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.54 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |