C21H30N2O3S — CID 2315531
[(4aS,8aS)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]-[1-(benzenesulfonyl)piperidin-4-yl]methanone (PubChem CID 2315531) has the molecular formula C21H30N2O3S and a molecular weight of 390.55 g/mol. Its IUPAC name is [(4aS,8aS)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]-[1-(benzenesulfonyl)piperidin-4-yl]methanone.
| Compound Name | [(4aS,8aS)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]-[1-(benzenesulfonyl)piperidin-4-yl]methanone |
|---|---|
| PubChem CID | 2315531 |
| Molecular Formula | C21H30N2O3S |
| Molecular Weight | 390.55 g/mol |
| Exact Mass | 390.20 |
| IUPAC Name | [(4aS,8aS)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]-[1-(benzenesulfonyl)piperidin-4-yl]methanone |
| SMILES | O=C(C1CCN(S(=O)(=O)c2ccccc2)CC1)N1CC[C@@H]2CCCC[C@@H]2C1 |
| InChI | InChI=1S/C21H30N2O3S/c24-21(22-13-10-17-6-4-5-7-19(17)16-22)18-11-14-23(15-12-18)27(25,26)20-8-2-1-3-9-20/h1-3,8-9,17-19H,4-7,10-16H2/t17-,19+/m0/s1 |
| InChIKey | OJLSQVWZMPOZCQ-PKOBYXMFSA-N |
| XLogP | 3.13 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.55 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |