C21H31N3O3S — CID 95552892
[(3S)-1-[1-(benzenesulfonyl)piperidin-4-yl]piperidin-3-yl]-pyrrolidin-1-ylmethanone (PubChem CID 95552892) has the molecular formula C21H31N3O3S and a molecular weight of 405.56 g/mol. Its IUPAC name is [(3S)-1-[1-(benzenesulfonyl)piperidin-4-yl]piperidin-3-yl]-pyrrolidin-1-ylmethanone.
| Compound Name | [(3S)-1-[1-(benzenesulfonyl)piperidin-4-yl]piperidin-3-yl]-pyrrolidin-1-ylmethanone |
|---|---|
| PubChem CID | 95552892 |
| Molecular Formula | C21H31N3O3S |
| Molecular Weight | 405.56 g/mol |
| Exact Mass | 405.21 |
| IUPAC Name | [(3S)-1-[1-(benzenesulfonyl)piperidin-4-yl]piperidin-3-yl]-pyrrolidin-1-ylmethanone |
| SMILES | O=C([C@H]1CCCN(C2CCN(S(=O)(=O)c3ccccc3)CC2)C1)N1CCCC1 |
| InChI | InChI=1S/C21H31N3O3S/c25-21(22-12-4-5-13-22)18-7-6-14-23(17-18)19-10-15-24(16-11-19)28(26,27)20-8-2-1-3-9-20/h1-3,8-9,18-19H,4-7,10-17H2/t18-/m0/s1 |
| InChIKey | HYTQXQRRBBQALM-SFHVURJKSA-N |
| XLogP | 2.17 |
| TPSA | 60.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.56 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |