C21H28N4O3S — CID 119034210
[1-(benzenesulfonyl)piperidin-3-yl]-[4-(5-methylimidazol-1-yl)piperidin-1-yl]methanone (PubChem CID 119034210) has the molecular formula C21H28N4O3S and a molecular weight of 416.55 g/mol. Its IUPAC name is [1-(benzenesulfonyl)piperidin-3-yl]-[4-(5-methylimidazol-1-yl)piperidin-1-yl]methanone.
| Compound Name | [1-(benzenesulfonyl)piperidin-3-yl]-[4-(5-methylimidazol-1-yl)piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 119034210 |
| Molecular Formula | C21H28N4O3S |
| Molecular Weight | 416.55 g/mol |
| Exact Mass | 416.19 |
| IUPAC Name | [1-(benzenesulfonyl)piperidin-3-yl]-[4-(5-methylimidazol-1-yl)piperidin-1-yl]methanone |
| SMILES | Cc1cncn1C1CCN(C(=O)C2CCCN(S(=O)(=O)c3ccccc3)C2)CC1 |
| InChI | InChI=1S/C21H28N4O3S/c1-17-14-22-16-25(17)19-9-12-23(13-10-19)21(26)18-6-5-11-24(15-18)29(27,28)20-7-3-2-4-8-20/h2-4,7-8,14,16,18-19H,5-6,9-13,15H2,1H3 |
| InChIKey | USVBFICXTJEXKS-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 75.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.55 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |