C24H29BrN2O3S — CID 126394359
(4-benzylpiperidin-1-yl)-[(3R)-1-(4-bromophenyl)sulfonylpiperidin-3-yl]methanone (PubChem CID 126394359) has the molecular formula C24H29BrN2O3S and a molecular weight of 505.48 g/mol. Its IUPAC name is (4-benzylpiperidin-1-yl)-[(3R)-1-(4-bromophenyl)sulfonylpiperidin-3-yl]methanone.
| Compound Name | (4-benzylpiperidin-1-yl)-[(3R)-1-(4-bromophenyl)sulfonylpiperidin-3-yl]methanone |
|---|---|
| PubChem CID | 126394359 |
| Molecular Formula | C24H29BrN2O3S |
| Molecular Weight | 505.48 g/mol |
| Exact Mass | 504.11 |
| IUPAC Name | (4-benzylpiperidin-1-yl)-[(3R)-1-(4-bromophenyl)sulfonylpiperidin-3-yl]methanone |
| SMILES | O=C([C@@H]1CCCN(S(=O)(=O)c2ccc(Br)cc2)C1)N1CCC(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C24H29BrN2O3S/c25-22-8-10-23(11-9-22)31(29,30)27-14-4-7-21(18-27)24(28)26-15-12-20(13-16-26)17-19-5-2-1-3-6-19/h1-3,5-6,8-11,20-21H,4,7,12-18H2/t21-/m1/s1 |
| InChIKey | OSGAONFPVDJTCF-OAQYLSRUSA-N |
| XLogP | 4.33 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.48 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |