C23H28BrN3O3S — CID 43926332
[4-(benzenesulfonyl)piperazin-1-yl]-[1-[(4-bromophenyl)methyl]piperidin-3-yl]methanone (PubChem CID 43926332) has the molecular formula C23H28BrN3O3S and a molecular weight of 506.47 g/mol. Its IUPAC name is [4-(benzenesulfonyl)piperazin-1-yl]-[1-[(4-bromophenyl)methyl]piperidin-3-yl]methanone.
| Compound Name | [4-(benzenesulfonyl)piperazin-1-yl]-[1-[(4-bromophenyl)methyl]piperidin-3-yl]methanone |
|---|---|
| PubChem CID | 43926332 |
| Molecular Formula | C23H28BrN3O3S |
| Molecular Weight | 506.47 g/mol |
| Exact Mass | 505.10 |
| IUPAC Name | [4-(benzenesulfonyl)piperazin-1-yl]-[1-[(4-bromophenyl)methyl]piperidin-3-yl]methanone |
| SMILES | O=C(C1CCCN(Cc2ccc(Br)cc2)C1)N1CCN(S(=O)(=O)c2ccccc2)CC1 |
| InChI | InChI=1S/C23H28BrN3O3S/c24-21-10-8-19(9-11-21)17-25-12-4-5-20(18-25)23(28)26-13-15-27(16-14-26)31(29,30)22-6-2-1-3-7-22/h1-3,6-11,20H,4-5,12-18H2 |
| InChIKey | VOCOXDYEMYLLGV-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 60.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.47 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |