C21H26ClN3O3S2 — CID 55986696
(1-benzylpiperidin-3-yl)-[4-(5-chlorothiophen-2-yl)sulfonylpiperazin-1-yl]methanone (PubChem CID 55986696) has the molecular formula C21H26ClN3O3S2 and a molecular weight of 468.04 g/mol. Its IUPAC name is (1-benzylpiperidin-3-yl)-[4-(5-chlorothiophen-2-yl)sulfonylpiperazin-1-yl]methanone.
| Compound Name | (1-benzylpiperidin-3-yl)-[4-(5-chlorothiophen-2-yl)sulfonylpiperazin-1-yl]methanone |
|---|---|
| PubChem CID | 55986696 |
| Molecular Formula | C21H26ClN3O3S2 |
| Molecular Weight | 468.04 g/mol |
| Exact Mass | 467.11 |
| IUPAC Name | (1-benzylpiperidin-3-yl)-[4-(5-chlorothiophen-2-yl)sulfonylpiperazin-1-yl]methanone |
| SMILES | O=C(C1CCCN(Cc2ccccc2)C1)N1CCN(S(=O)(=O)c2ccc(Cl)s2)CC1 |
| InChI | InChI=1S/C21H26ClN3O3S2/c22-19-8-9-20(29-19)30(27,28)25-13-11-24(12-14-25)21(26)18-7-4-10-23(16-18)15-17-5-2-1-3-6-17/h1-3,5-6,8-9,18H,4,7,10-16H2 |
| InChIKey | YQFHJNANDQVICF-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 60.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.04 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |