C14H19ClN2O4S2 — CID 31137350
[4-(5-chlorothiophen-2-yl)sulfonylpiperazin-1-yl]-(oxan-4-yl)methanone (PubChem CID 31137350) has the molecular formula C14H19ClN2O4S2 and a molecular weight of 378.90 g/mol. Its IUPAC name is [4-(5-chlorothiophen-2-yl)sulfonylpiperazin-1-yl]-(oxan-4-yl)methanone.
| Compound Name | [4-(5-chlorothiophen-2-yl)sulfonylpiperazin-1-yl]-(oxan-4-yl)methanone |
|---|---|
| PubChem CID | 31137350 |
| Molecular Formula | C14H19ClN2O4S2 |
| Molecular Weight | 378.90 g/mol |
| Exact Mass | 378.05 |
| IUPAC Name | [4-(5-chlorothiophen-2-yl)sulfonylpiperazin-1-yl]-(oxan-4-yl)methanone |
| SMILES | O=C(C1CCOCC1)N1CCN(S(=O)(=O)c2ccc(Cl)s2)CC1 |
| InChI | InChI=1S/C14H19ClN2O4S2/c15-12-1-2-13(22-12)23(19,20)17-7-5-16(6-8-17)14(18)11-3-9-21-10-4-11/h1-2,11H,3-10H2 |
| InChIKey | JJPZSZKUNJJUBB-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.90 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |