C17H26ClN3O3S2 — CID 55986695
[4-(5-chlorothiophen-2-yl)sulfonylpiperazin-1-yl]-(1-propylpiperidin-2-yl)methanone (PubChem CID 55986695) has the molecular formula C17H26ClN3O3S2 and a molecular weight of 420.00 g/mol. Its IUPAC name is [4-(5-chlorothiophen-2-yl)sulfonylpiperazin-1-yl]-(1-propylpiperidin-2-yl)methanone.
| Compound Name | [4-(5-chlorothiophen-2-yl)sulfonylpiperazin-1-yl]-(1-propylpiperidin-2-yl)methanone |
|---|---|
| PubChem CID | 55986695 |
| Molecular Formula | C17H26ClN3O3S2 |
| Molecular Weight | 420.00 g/mol |
| Exact Mass | 419.11 |
| IUPAC Name | [4-(5-chlorothiophen-2-yl)sulfonylpiperazin-1-yl]-(1-propylpiperidin-2-yl)methanone |
| SMILES | CCCN1CCCCC1C(=O)N1CCN(S(=O)(=O)c2ccc(Cl)s2)CC1 |
| InChI | InChI=1S/C17H26ClN3O3S2/c1-2-8-19-9-4-3-5-14(19)17(22)20-10-12-21(13-11-20)26(23,24)16-7-6-15(18)25-16/h6-7,14H,2-5,8-13H2,1H3 |
| InChIKey | ZXAZLUCFPZBJNH-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 60.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.00 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |