C20H24BrN3O3S2 — CID 60563338
(1-benzylpyrrolidin-2-yl)-[4-(5-bromothiophen-2-yl)sulfonylpiperazin-1-yl]methanone (PubChem CID 60563338) has the molecular formula C20H24BrN3O3S2 and a molecular weight of 498.47 g/mol. Its IUPAC name is (1-benzylpyrrolidin-2-yl)-[4-(5-bromothiophen-2-yl)sulfonylpiperazin-1-yl]methanone.
| Compound Name | (1-benzylpyrrolidin-2-yl)-[4-(5-bromothiophen-2-yl)sulfonylpiperazin-1-yl]methanone |
|---|---|
| PubChem CID | 60563338 |
| Molecular Formula | C20H24BrN3O3S2 |
| Molecular Weight | 498.47 g/mol |
| Exact Mass | 497.04 |
| IUPAC Name | (1-benzylpyrrolidin-2-yl)-[4-(5-bromothiophen-2-yl)sulfonylpiperazin-1-yl]methanone |
| SMILES | O=C(C1CCCN1Cc1ccccc1)N1CCN(S(=O)(=O)c2ccc(Br)s2)CC1 |
| InChI | InChI=1S/C20H24BrN3O3S2/c21-18-8-9-19(28-18)29(26,27)24-13-11-22(12-14-24)20(25)17-7-4-10-23(17)15-16-5-2-1-3-6-16/h1-3,5-6,8-9,17H,4,7,10-15H2 |
| InChIKey | HJPREGOXMXSGTB-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 60.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.47 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |