C11H15BrN2O3S3 — CID 9298446
1-[4-(5-bromothiophen-2-yl)sulfonylpiperazin-1-yl]-2-methylsulfanylethanone (PubChem CID 9298446) has the molecular formula C11H15BrN2O3S3 and a molecular weight of 399.36 g/mol. Its IUPAC name is 1-[4-(5-bromothiophen-2-yl)sulfonylpiperazin-1-yl]-2-methylsulfanylethanone.
| Compound Name | 1-[4-(5-bromothiophen-2-yl)sulfonylpiperazin-1-yl]-2-methylsulfanylethanone |
|---|---|
| PubChem CID | 9298446 |
| Molecular Formula | C11H15BrN2O3S3 |
| Molecular Weight | 399.36 g/mol |
| Exact Mass | 397.94 |
| IUPAC Name | 1-[4-(5-bromothiophen-2-yl)sulfonylpiperazin-1-yl]-2-methylsulfanylethanone |
| SMILES | CSCC(=O)N1CCN(S(=O)(=O)c2ccc(Br)s2)CC1 |
| InChI | InChI=1S/C11H15BrN2O3S3/c1-18-8-10(15)13-4-6-14(7-5-13)20(16,17)11-3-2-9(12)19-11/h2-3H,4-8H2,1H3 |
| InChIKey | ANFMOKGOCGNFPI-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.36 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |