C12H18BrN3O3S2 — CID 8685029
N-[2-[4-(5-bromothiophen-2-yl)sulfonylpiperazin-1-yl]ethyl]acetamide (PubChem CID 8685029) has the molecular formula C12H18BrN3O3S2 and a molecular weight of 396.33 g/mol. Its IUPAC name is N-[2-[4-(5-bromothiophen-2-yl)sulfonylpiperazin-1-yl]ethyl]acetamide.
| Compound Name | N-[2-[4-(5-bromothiophen-2-yl)sulfonylpiperazin-1-yl]ethyl]acetamide |
|---|---|
| PubChem CID | 8685029 |
| Molecular Formula | C12H18BrN3O3S2 |
| Molecular Weight | 396.33 g/mol |
| Exact Mass | 395.00 |
| IUPAC Name | N-[2-[4-(5-bromothiophen-2-yl)sulfonylpiperazin-1-yl]ethyl]acetamide |
| SMILES | CC(=O)NCCN1CCN(S(=O)(=O)c2ccc(Br)s2)CC1 |
| InChI | InChI=1S/C12H18BrN3O3S2/c1-10(17)14-4-5-15-6-8-16(9-7-15)21(18,19)12-3-2-11(13)20-12/h2-3H,4-9H2,1H3,(H,14,17) |
| InChIKey | XGTCEGYTOBXYGF-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.33 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |