C15H18BrN3O4S2 — CID 38797770
2-[4-(5-bromothiophen-2-yl)sulfonylpiperazin-1-yl]-N-(furan-2-ylmethyl)acetamide (PubChem CID 38797770) has the molecular formula C15H18BrN3O4S2 and a molecular weight of 448.36 g/mol. Its IUPAC name is 2-[4-(5-bromothiophen-2-yl)sulfonylpiperazin-1-yl]-N-(furan-2-ylmethyl)acetamide.
| Compound Name | 2-[4-(5-bromothiophen-2-yl)sulfonylpiperazin-1-yl]-N-(furan-2-ylmethyl)acetamide |
|---|---|
| PubChem CID | 38797770 |
| Molecular Formula | C15H18BrN3O4S2 |
| Molecular Weight | 448.36 g/mol |
| Exact Mass | 446.99 |
| IUPAC Name | 2-[4-(5-bromothiophen-2-yl)sulfonylpiperazin-1-yl]-N-(furan-2-ylmethyl)acetamide |
| SMILES | O=C(CN1CCN(S(=O)(=O)c2ccc(Br)s2)CC1)NCc1ccco1 |
| InChI | InChI=1S/C15H18BrN3O4S2/c16-13-3-4-15(24-13)25(21,22)19-7-5-18(6-8-19)11-14(20)17-10-12-2-1-9-23-12/h1-4,9H,5-8,10-11H2,(H,17,20) |
| InChIKey | OYXWTNIUQGLTMV-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 82.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.36 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |