C18H15BrN2O6S2 — CID 2358193
[2-(furan-2-ylmethylamino)-2-oxoethyl] 4-[(5-bromothiophen-2-yl)sulfonylamino]benzoate (PubChem CID 2358193) has the molecular formula C18H15BrN2O6S2 and a molecular weight of 499.36 g/mol. Its IUPAC name is [2-(furan-2-ylmethylamino)-2-oxoethyl] 4-[(5-bromothiophen-2-yl)sulfonylamino]benzoate.
| Compound Name | [2-(furan-2-ylmethylamino)-2-oxoethyl] 4-[(5-bromothiophen-2-yl)sulfonylamino]benzoate |
|---|---|
| PubChem CID | 2358193 |
| Molecular Formula | C18H15BrN2O6S2 |
| Molecular Weight | 499.36 g/mol |
| Exact Mass | 497.96 |
| IUPAC Name | [2-(furan-2-ylmethylamino)-2-oxoethyl] 4-[(5-bromothiophen-2-yl)sulfonylamino]benzoate |
| SMILES | O=C(COC(=O)c1ccc(NS(=O)(=O)c2ccc(Br)s2)cc1)NCc1ccco1 |
| InChI | InChI=1S/C18H15BrN2O6S2/c19-15-7-8-17(28-15)29(24,25)21-13-5-3-12(4-6-13)18(23)27-11-16(22)20-10-14-2-1-9-26-14/h1-9,21H,10-11H2,(H,20,22) |
| InChIKey | HLRKUDDDFJUJHZ-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 114.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.36 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |