C22H19N3O8S4 — CID 25038628
[2-(furan-2-ylmethylamino)-2-oxoethyl] 3,5-bis(thiophen-2-ylsulfonylamino)benzoate (PubChem CID 25038628) has the molecular formula C22H19N3O8S4 and a molecular weight of 581.68 g/mol. Its IUPAC name is [2-(furan-2-ylmethylamino)-2-oxoethyl] 3,5-bis(thiophen-2-ylsulfonylamino)benzoate.
| Compound Name | [2-(furan-2-ylmethylamino)-2-oxoethyl] 3,5-bis(thiophen-2-ylsulfonylamino)benzoate |
|---|---|
| PubChem CID | 25038628 |
| Molecular Formula | C22H19N3O8S4 |
| Molecular Weight | 581.68 g/mol |
| Exact Mass | 581.01 |
| IUPAC Name | [2-(furan-2-ylmethylamino)-2-oxoethyl] 3,5-bis(thiophen-2-ylsulfonylamino)benzoate |
| SMILES | O=C(COC(=O)c1cc(NS(=O)(=O)c2cccs2)cc(NS(=O)(=O)c2cccs2)c1)NCc1ccco1 |
| InChI | InChI=1S/C22H19N3O8S4/c26-19(23-13-18-4-1-7-32-18)14-33-22(27)15-10-16(24-36(28,29)20-5-2-8-34-20)12-17(11-15)25-37(30,31)21-6-3-9-35-21/h1-12,24-25H,13-14H2,(H,23,26) |
| InChIKey | QTVNDAJTAHQZQR-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 160.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.68 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |