C11H12N2O4S2 — CID 38254401
N-(furan-2-ylmethyl)-2-(thiophen-2-ylsulfonylamino)acetamide (PubChem CID 38254401) has the molecular formula C11H12N2O4S2 and a molecular weight of 300.36 g/mol. Its IUPAC name is N-(furan-2-ylmethyl)-2-(thiophen-2-ylsulfonylamino)acetamide.
| Compound Name | N-(furan-2-ylmethyl)-2-(thiophen-2-ylsulfonylamino)acetamide |
|---|---|
| PubChem CID | 38254401 |
| Molecular Formula | C11H12N2O4S2 |
| Molecular Weight | 300.36 g/mol |
| Exact Mass | 300.02 |
| IUPAC Name | N-(furan-2-ylmethyl)-2-(thiophen-2-ylsulfonylamino)acetamide |
| SMILES | O=C(CNS(=O)(=O)c1cccs1)NCc1ccco1 |
| InChI | InChI=1S/C11H12N2O4S2/c14-10(12-7-9-3-1-5-17-9)8-13-19(15,16)11-4-2-6-18-11/h1-6,13H,7-8H2,(H,12,14) |
| InChIKey | SUAALPXXFPZWIJ-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 88.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.36 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |