C12H13N3O3S2 — CID 112993206
N-(pyridin-4-ylmethyl)-2-(thiophen-2-ylsulfonylamino)acetamide (PubChem CID 112993206) has the molecular formula C12H13N3O3S2 and a molecular weight of 311.39 g/mol. Its IUPAC name is N-(pyridin-4-ylmethyl)-2-(thiophen-2-ylsulfonylamino)acetamide.
| Compound Name | N-(pyridin-4-ylmethyl)-2-(thiophen-2-ylsulfonylamino)acetamide |
|---|---|
| PubChem CID | 112993206 |
| Molecular Formula | C12H13N3O3S2 |
| Molecular Weight | 311.39 g/mol |
| Exact Mass | 311.04 |
| IUPAC Name | N-(pyridin-4-ylmethyl)-2-(thiophen-2-ylsulfonylamino)acetamide |
| SMILES | O=C(CNS(=O)(=O)c1cccs1)NCc1ccncc1 |
| InChI | InChI=1S/C12H13N3O3S2/c16-11(14-8-10-3-5-13-6-4-10)9-15-20(17,18)12-2-1-7-19-12/h1-7,15H,8-9H2,(H,14,16) |
| InChIKey | UPJHSNUBGHOHTH-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 88.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.39 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |