C15H15ClN2O5S2 — CID 43065279
[2-[(4-chlorophenyl)methylamino]-2-oxoethyl] 2-(thiophen-2-ylsulfonylamino)acetate (PubChem CID 43065279) has the molecular formula C15H15ClN2O5S2 and a molecular weight of 402.88 g/mol. Its IUPAC name is [2-[(4-chlorophenyl)methylamino]-2-oxoethyl] 2-(thiophen-2-ylsulfonylamino)acetate.
| Compound Name | [2-[(4-chlorophenyl)methylamino]-2-oxoethyl] 2-(thiophen-2-ylsulfonylamino)acetate |
|---|---|
| PubChem CID | 43065279 |
| Molecular Formula | C15H15ClN2O5S2 |
| Molecular Weight | 402.88 g/mol |
| Exact Mass | 402.01 |
| IUPAC Name | [2-[(4-chlorophenyl)methylamino]-2-oxoethyl] 2-(thiophen-2-ylsulfonylamino)acetate |
| SMILES | O=C(COC(=O)CNS(=O)(=O)c1cccs1)NCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C15H15ClN2O5S2/c16-12-5-3-11(4-6-12)8-17-13(19)10-23-14(20)9-18-25(21,22)15-2-1-7-24-15/h1-7,18H,8-10H2,(H,17,19) |
| InChIKey | OEHHWTKIGYTLRI-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.88 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |