C21H20N2O5S2 — CID 2620126
[2-[(4-methylphenyl)methylamino]-2-oxoethyl] 2-(thiophen-2-ylsulfonylamino)benzoate (PubChem CID 2620126) has the molecular formula C21H20N2O5S2 and a molecular weight of 444.53 g/mol. Its IUPAC name is [2-[(4-methylphenyl)methylamino]-2-oxoethyl] 2-(thiophen-2-ylsulfonylamino)benzoate.
| Compound Name | [2-[(4-methylphenyl)methylamino]-2-oxoethyl] 2-(thiophen-2-ylsulfonylamino)benzoate |
|---|---|
| PubChem CID | 2620126 |
| Molecular Formula | C21H20N2O5S2 |
| Molecular Weight | 444.53 g/mol |
| Exact Mass | 444.08 |
| IUPAC Name | [2-[(4-methylphenyl)methylamino]-2-oxoethyl] 2-(thiophen-2-ylsulfonylamino)benzoate |
| SMILES | Cc1ccc(CNC(=O)COC(=O)c2ccccc2NS(=O)(=O)c2cccs2)cc1 |
| InChI | InChI=1S/C21H20N2O5S2/c1-15-8-10-16(11-9-15)13-22-19(24)14-28-21(25)17-5-2-3-6-18(17)23-30(26,27)20-7-4-12-29-20/h2-12,23H,13-14H2,1H3,(H,22,24) |
| InChIKey | JEJPRQCAZFNDHF-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.53 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |