C20H17NO6S2 — CID 30906041
2-benzoyloxyethyl 2-(thiophen-2-ylsulfonylamino)benzoate (PubChem CID 30906041) has the molecular formula C20H17NO6S2 and a molecular weight of 431.49 g/mol. Its IUPAC name is 2-benzoyloxyethyl 2-(thiophen-2-ylsulfonylamino)benzoate.
| Compound Name | 2-benzoyloxyethyl 2-(thiophen-2-ylsulfonylamino)benzoate |
|---|---|
| PubChem CID | 30906041 |
| Molecular Formula | C20H17NO6S2 |
| Molecular Weight | 431.49 g/mol |
| Exact Mass | 431.05 |
| IUPAC Name | 2-benzoyloxyethyl 2-(thiophen-2-ylsulfonylamino)benzoate |
| SMILES | O=C(OCCOC(=O)c1ccccc1NS(=O)(=O)c1cccs1)c1ccccc1 |
| InChI | InChI=1S/C20H17NO6S2/c22-19(15-7-2-1-3-8-15)26-12-13-27-20(23)16-9-4-5-10-17(16)21-29(24,25)18-11-6-14-28-18/h1-11,14,21H,12-13H2 |
| InChIKey | NDCWPCNAVYAHBE-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 98.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.49 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|