C15H17NO4S2 — CID 18157559
butyl 2-(thiophen-2-ylsulfonylamino)benzoate (PubChem CID 18157559) has the molecular formula C15H17NO4S2 and a molecular weight of 339.44 g/mol. Its IUPAC name is butyl 2-(thiophen-2-ylsulfonylamino)benzoate.
| Compound Name | butyl 2-(thiophen-2-ylsulfonylamino)benzoate |
|---|---|
| PubChem CID | 18157559 |
| Molecular Formula | C15H17NO4S2 |
| Molecular Weight | 339.44 g/mol |
| Exact Mass | 339.06 |
| IUPAC Name | butyl 2-(thiophen-2-ylsulfonylamino)benzoate |
| SMILES | CCCCOC(=O)c1ccccc1NS(=O)(=O)c1cccs1 |
| InChI | InChI=1S/C15H17NO4S2/c1-2-3-10-20-15(17)12-7-4-5-8-13(12)16-22(18,19)14-9-6-11-21-14/h4-9,11,16H,2-3,10H2,1H3 |
| InChIKey | MTDMMQNQNRGENZ-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.44 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|